Methyl 2,3,4-tri-O-benzyl ribopyranose
Methyl 2,3,4-tri-O-benzyl ribopyranose is a key compound used industry. With its unique chemical structure, it plays a critical role in the synthesis of various drugs targeting diseases like cancer and diabetes. This versatile compound offers potential applications in the development of novel pharmaceutical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20787-20-6 |
| Pricing | Inquire |
| Cas | 20787-20-6 |
| Molecular Weight | 434.5 |
| Molecular Formula | C27H30O5 |
| Canonical SMILES | COC1C(C(C(CO1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |