3,5-DIMETHOXYBENZYLZINC CHLORIDE
3,5-Dimethoxybenzylzinc chloride is a crucial reagent used in the biomedicine industry. It effectively aids in the synthesis of various pharmaceutical drugs targeting diseases such as cancer, diabetes, and neurological disorders by facilitating crucial chemical reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352530-33-7 |
| Pricing | Inquire |
| Cas | 352530-33-7 |
| Molecular Weight | 252.03 |
| Molecular Formula | C9H11ClO2Zn |
| Canonical SMILES | COC1=CC(=CC(=C1)[CH2-])OC.Cl[Zn+] |