UDP-N-acetyl-D-glucosamine disodium salt
UDP-N-acetyl-D-glucosamine disodium salt is a crucial biochemical used in the biomedical industry for the synthesis of glycosaminoglycans, antibiotics and antifungal compounds. It plays a vital role in studying bacterial and fungal infections, as well as assisting in the production of certain drugs targeting diseases like cancer and arthritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 91183-98-1 |
| Pricing | Inquire |
| Cas | 91183-98-1 |
| Molecular Weight | 651.32 |
| Molecular Formula | C17H25N3O17P2Na2 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OP(=O)([O-])OP(=O)([O-])OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)CO)O)O.[Na+].[Na+] |