Reactive blue 2 (C.I. 61211)
Reactive Blue 2 (C.I. 61211), a synthetic dye prevalent in biomedical research and pharmaceutical applications, serves as a crucial tool for staining, labeling, and drug delivery. Its versatile nature allows for targeted therapeutic interventions in diseases like cancer and inflammation, showcasing its paramount importance in scientific endeavors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 12236-82-7 |
| Pricing | Inquire |
| Cas | 12236-82-7 |
| Molecular Weight | 774.1574 |
| Molecular Formula | C29H17ClN7Na3O11S3 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3NC4=CC(=C(C=C4)NC5=NC(=NC(=N5)NC6=CC(=CC=C6)S(=O)(=O)O)Cl)S(=O)(=O)O)S(=O)(=O)O)N |