PPPA
PPPA is a competitive NMDA receptor antagonist that displays moderate selectivity for NR2A-containing receptors (Ki=0.13, 0.47, 1.10 and 3.86 μM for GluN2A, GluN2B, GluN2C and GluN2D subunits respectively). Some findings support the hypothesis that PPPA and reward synergize to enhance initiate dopamine (DA) excitation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 113190-92-4 |
| Pricing | Inquire |
| Cas | 113190-92-4 |
| Molecular Weight | 251.22 |
| Molecular Formula | C9H18NO5P |
| Canonical SMILES | C1CNC(CC1CCCP(=O)(O)O)C(=O)O |