Mycothiol disulfide - Stabilised with trifluoroacetic acid ammonium salt
Mycothiol Disulfide is an indispensable biomedical compound,diligently aiding in studying an extensive array of tenacious bacterial infections. Its unparalleled prowess lies in its capacity to effectively obstruct bacterial proliferation while effortlessly surmounting drug resistance mechanisms. Elevating its impact further is a fortified formulation merged with the trifluoroacetic acid ammonium salt embodies unfaltering stability and amplified effectiveness.
| Supplier | BOC Sciences |
|---|---|
| Product # | 192126-76-4 |
| Pricing | Inquire |
| Cas | 192126-76-4 |
| Molecular Weight | 970.97 |
| Molecular Formula | C34H58N4O24S2 |
| Canonical SMILES | CC(=O)NC(CS)C(=O)NC1C(C(C(OC1OC2C(C(C(C(C2O)O)O)O)O)CO)O)O |