3-Chlorosulfonyl-4-chlorobenzoylbenzoic Acid
3-Chlorosulfonyl-4-chlorobenzoylbenzoic Acid is a potent pharmaceutical compound extensively used in the research of inflammatory diseases, such as rheumatoid arthritand psoriasis. It functions by inhibiting specific enzymes involved in the inflammatory process.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68592-12-1 |
| Pricing | Inquire |
| Cas | 68592-12-1 |
| Molecular Weight | 359.19 |
| Molecular Formula | C14H8Cl2O5S |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)Cl)C(=O)O |