AZD 2066
AZD 2066 is a mGluR5 anatagonist. It displays discriminative effects in rats. It is brain penetrant and orally bioavailable. It is used to prevent and treat pain, psychiatric, neurological and other diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 934282-55-0 |
| Pricing | Inquire |
| Cas | 934282-55-0 |
| Molecular Weight | 381.82 |
| Molecular Formula | C19H16ClN5O2 |
| Canonical SMILES | CC(C1=NOC(=C1)C2=CC(=CC=C2)Cl)OC3=NN=C(N3C)C4=CC=NC=C4 |