Anlotinib
Anlotibib is a multi-targetes kinase inhibitor of receptor tyrosine and could effectively resist the formation of new angiogenesis. It is undergoing a phase III clinical trial for therapy of metastatic or advanced alveolar soft part sarcoma (ASPS), leiomyosarcoma (LMS), and synovial sarcoma (SS).
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-474328 |
| Pricing | Inquire |
| Cas | 1058156-90-3 |
| Molecular Weight | 407.445 |
| Molecular Formula | C23H22FN3O3 |
| Canonical SMILES | CC1=CC2=C(N1)C=CC(=C2F)OC3=C4C=C(C(=CC4=NC=C3)OCC5(CC5)N)OC |