BDP 630/650 X NHS ester
BDP 630/650 is a borondipyrromethene fluorophore that has a high molar extinction coefficient, excellent quantum yield, and a relatively long lifetime of the excited state. Due to it, this fluorophore is useful for fluorescence polarization assays that allow to detect binding between molecules. This is an amine reactive NHS ester. It contains an aminohexanoyl linker between the fluorophore and the reactive group.
| Supplier | BOC Sciences |
|---|---|
| Product # | R01-0007 |
| Pricing | Inquire |
| Cas | 2213445-35-1 |
| Molecular Weight | 660.5 |
| Molecular Formula | C33H31N4BF2O6S |
| Canonical SMILES | [B-]1(N2C(=CC=C2C=CC3=CC=C(C=C3)OCC(=O)NCCCCCC(=O)ON4C(=O)CCC4=O)C=C5[N+]1=C(C=C5)C6=CC=CS6)(F)F |