Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) is widely utilized in the biomedical industry as a catalyst for various organic transformations. It plays a crucial role in synthesizing drugs, such as anti-cancer agents, by facilitating critical reactions. Additionally, Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) is involved in the development of innovative therapies for neurodegenerative diseases through its catalytic properties
| Supplier | BOC Sciences |
|---|---|
| Product # | 31277-98-2 |
| Pricing | Inquire |
| Cas | 31277-98-2 |
| Molecular Weight | 903.25 |
| Molecular Formula | [(C6H5)2PCH2CH2P(C6H5)2]2Pd |
| Canonical SMILES | C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.[Pd] |