benzyl 2-acetamido-4,6-di-O-benzyl-2-deoxy-α-D-glucopyranoside
Benzyl 2-acetamido-4,6-di-O-benzyl-2-deoxy-α-D-glucopyranoside - a remarkable small molecule glycoscience innovation - is widely used in the biomedical and pharmaceutical research fields owing to its potential in tackling various ailments, ranging from cancer to neurological disorders to bacterial infections. Its success can be attributed to its strong enzyme-inhibiting properties that modulate immune response pathways. Alongside this, it is also a pivotal tool for drug discovery and development as well as glycosylation research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73646-11-4 |
| Pricing | Inquire |
| Cas | 73646-11-4 |
| Molecular Weight | 491.58 |
| Molecular Formula | C29H33NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCC2=CC=CC=C2)COCC3=CC=CC=C3)OCC4=CC=CC=C4)O |