Di-tert-butyl Allenylphosphonate
Di-tert-butyl Allenylphosphonate is an intermediate in the synthesis of cis-Propenylphosphonic Acid (R)-(+)-α-Methylbenzylamine Salt (P768980) which is used as a reagent in the microbial production of Fosfomycin (F727505); a compound used as an antibiotic in the treatment of urinary tract infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB062811 |
| Pricing | Inquire |
| Cas | 25383-48-6 |
| Molecular Weight | 232.26 |
| Molecular Formula | C11H21O3P |
| Canonical SMILES | CC(C)(C)OP(=O)(C=C=C)OC(C)(C)C |