Scytalidin
It is a terpenoid antibiotic produced by the strain of Scytalidium sp. FSC-470. It has antifungal effect. The antibacterial activity is strongest when the pH value of liquid determination is 3.5, and the activity decreases when the pH value increases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02890 |
| Pricing | Inquire |
| Cas | 39012-16-3 |
| Molecular Weight | 404.45 |
| Molecular Formula | C22H28O7 |
| Canonical SMILES | CCCCCC1CC2=C(CC(CC3=C1C(=O)OC3=O)(CCCC)O)C(=O)OC2=O |