BP Lipid 122
BP Lipid 122 is an ionizable amine lipid with ethanolamine head which can efficiently encapsulate mRNA. Ester linkages are incorporated in the structure at C8 adn C6 position relative to amine. These introduction of ester bonds can increase tissue clearance of the lipid in the liver. The primary ester at C8 poisition has a 7-carbons lipid tail. The lipid can be used for mRNA-based therapies which depends on the availability of a safe and efficient delivery vehicle.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-3714 |
| Pricing | Inquire |
| Molecular Weight | 654.1 |
| Molecular Formula | C40H79NO5 |
| Canonical SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCCCCCCC(=O)OCCCCCCC)CCO |