Bezafibrate
Bezafibrate (marketed as Bezalip and various other brand names) is a fibrate drug used for the treatment of hyperlipidaemia. It helps to lower LDL cholesterol and triglyceride in the blood, and increase HDL.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2766 |
| Pricing | Inquire |
| Cas | 41859-67-0 |
| Molecular Weight | 361.82 |
| Molecular Formula | C19H20ClNO4 |
| Canonical SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |