Diosmetin
Diosmetin is a flavonoid that inhibits cytochrome P450 (CYP) isoforms 1A1 and 1B1 in human liver microsomes (Ki values of 89 and 16 nM, respectively). It exhibits anti-mutagenic and anti-allergic properties. Diosmetin has anti-oxidation, anti-infection, anti-shock and other functional foods, cosmetics and future drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2523 |
| Pricing | Inquire |
| Cas | 520-34-3 |
| Molecular Weight | 300.266 |
| Molecular Formula | C16H12O6 |
| Canonical SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |