CAY10510
Prostaglandin F2α (PGF2α in prostanoid nomenclature) is a naturally occurring prostaglandin used in medicine to induce labor and as an abortifacient. CAY10510 is an analog of PGF2α containing an acetylenic fluorobenzene substituent in the lower side chain, which has an IC50 of 0.5 nM when tested for binding to the recombinant human FP receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 291303-34-9 |
| Pricing | Inquire |
| Cas | 291303-34-9 |
| Molecular Weight | 420.5 |
| Molecular Formula | C24H33FO5 |
| Canonical SMILES | FC(C=CC=C1)=C1C#CC(O)CC[C@H]2[C@H](O)C[C@H](O)[C@@H]2CCCCCCC(OC)=O |