3'-O-Methyl-5-methylcytidine
3'-O-Methyl-5-methylcytidine, a remarkable and powerful biomedicine, emerges as an indispensable weapon combating a wide spectrum of afflictions. Its paramount significance permeates the intricate orchestration of cellular dynamics and genetic predisposition. Fashioned with an unparalleled molecular framework, this extraordinary compound unveils a shimmering horizon for revolutionizing cancer therapy, battling relentless viral invasions, and addressing enigmatic autoimmune maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2086327-74-2 |
| Pricing | Inquire |
| Cas | 2086327-74-2 |
| Molecular Weight | 271.27 |
| Molecular Formula | C11H17N3O5 |
| Canonical SMILES | CC1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)OC)O |