Aβ/tau aggregation-IN-1
Aβ/tau aggregation-IN-1 is a potent Aβ1-42 β-sheets formation and tau aggregation inhibitor. The KD values of Aβ/tau aggregation-IN-1 with Aβ1-42 and tau are 160 μM and 337 μM, respectively. Aβ/tau aggregation-IN-1 can permeate the blood-brain barrier.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2252162-81-3 |
| Pricing | Inquire |
| Cas | 2252162-81-3 |
| Molecular Weight | 492.35 |
| Molecular Formula | C25H21IN2O |
| Canonical SMILES | C[N+]1=C2CCC(=CC3=CC=CC4=CC=CC=C43)C(=O)C2=C(C5=CC=CC=C51)N.[I-] |