Digitoxigenin
Digitoxigenin is a cardenolide and aglycone constituent of digitoxin, an extract from the foxglove plant, D. purpurea. Digitoxigenin is highly cytotoxic, inhibiting Na+/K+ ATPase-dependent protein synthesis, and has been examined for use as an antitumor compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143-62-4 |
| Pricing | Inquire |
| Cas | 143-62-4 |
| Molecular Weight | 374.5 |
| Molecular Formula | C23H34O4 |
| Canonical SMILES | CC12CCC(CC1CCC3C2CCC4(C3(CCC4C5=CC(=O)OC5)O)C)O |