6α-Methylprednisolone 21-Hemisuccinate Sodium Salt
6α-Methylprednisolone 21-hemisuccinate, a derivative of prednisolone, is a kind of glucocorticoids. It has been developed for having longer half-life than that of Prednisolone and the potential anti-inflammatory effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2375-03-3 |
| Pricing | Inquire |
| Cas | 2375-03-3 |
| Molecular Weight | 496.53 |
| Molecular Formula | C26H33NaO8 |
| Canonical SMILES | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)[O-])O.[Na+] |