para-Hydroxy Atorvastatin Calcium Salt
para-Hydroxy Atorvastatin Calcium Salt is a calcium salt form of para-Hydroxy Atorvastatin, a drug primarily used to treat high cholesterol and triglyceride levels in the blood. It is a potent and selective competitive inhibitor of HMG-CoA reductase is an enzyme involved in cholesterol synthesis. The calcium salt form enhances the stability and bioavailability of the compound, making it more suitable for pharmaceutical formulations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 265989-44-4 |
| Pricing | Inquire |
| Cas | 265989-44-4 |
| Molecular Weight | 1187.36 |
| Molecular Formula | C66H68CaF2N4O12 |
| Canonical SMILES | CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=C(C=C4)O.CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=C(C=C4)O.[Ca+2] |