Methyl 2-acetamido-2-deoxy-a-D-glucopyranoside
Methyl 2-acetamido-2-deoxy-a-D-glucopyranoside is a biomedicine product commonly used in the treatment of various infectious diseases caused by bacteria or viruses. It exhibits antimicrobial properties and functions by inhibiting the growth or replication of these pathogens. This compound can be utilized in the development of pharmaceutical drugs targeting specific pathogens to combat infections and promote better health outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-095470 |
| Pricing | Inquire |
| Cas | 6082-04-8 |
| Molecular Weight | 235.23 |
| Molecular Formula | C9H17NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC)CO)O)O |