1-Amino-8-benzyloxy-9-(b-D-xylofuranosyl)guanine
1-Amino-8-benzyloxy-9-(b-D-xylofuranosyl)guanine serves as an antiviral nucleoside analogue drug primarily used to mitigate herpes simplex virus infections. Its mechanism of action involves limiting the activity of viral DNA polymerase, which culminates in the hindrance of viral replication. This therapeutic option remains popular in managing herpes simplex virus infections affecting the immunocompromised and critically ill.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2389988-20-7 |
| Pricing | Inquire |
| Cas | 2389988-20-7 |
| Molecular Weight | 404.38 |
| Molecular Formula | C17H20N6O6 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=NC3=C(N2C4C(C(C(O4)CO)O)O)N=C(N(C3=O)N)N |