IKK 16 hydrochloride
IKK 16 hydrochloride is a potent and selective IκB kinase (IKK) inhibitor with IC50s of 40, 70 and 200 nM for IKKβ, IKK complex and IKKα, respectively. It inhibits TNFα-stimulated expression of the adhesion molecules E-selectin, ICAM-1, and VCAM-1 in HUVEC cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-470817 |
| Pricing | Inquire |
| Cas | 1186195-62-9 |
| Molecular Weight | 520.09 |
| Molecular Formula | C28H30ClN5OS |
| Canonical SMILES | O=C(C1=CC=C(NC2=NC=CC(C3=CC4=CC=CC=C4S3)=N2)C=C1)N5CCC(N6CCCC6)CC5.[H]Cl |