L-Tyrosine tert-butyl ester
L-Tyrosine tert-butyl ester is a protected form of L-Tyrosine. L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16874-12-7 |
| Pricing | Inquire |
| Cas | 16874-12-7 |
| Molecular Weight | 237.30 |
| Molecular Formula | C13H19NO3 |
| Canonical SMILES | CC(C)(C)OC(=O)C(CC1=CC=C(C=C1)O)N |