Phenyl b-D-galactopyranoside
Phenyl b-D-galactopyranoside, a colorless and crystalline compound, embodies a multifaceted organic essence, exhibiting its biomedical utility as a chromogenic substrate for β-galactosidase activity detection in the realm of cutting-edge biomedical research. On the other hand, its application as differential media in microbiology, serves as a shield, dispelling gram-negative bacteria, contributing significantly to environmental sustainability. Furthermore, the antibacterial properties of this compound against gram-negative bacteria have incited possible avenues for pharmacological research and may hold the potential for developing novel antimicrobial drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2818-58-8 |
| Pricing | Inquire |
| Cas | 2818-58-8 |
| Molecular Weight | 256.25 |
| Molecular Formula | C12H16O6 |
| Canonical SMILES | C1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |