17:1 Lyso PA ammonium salt
17:1 Lyso PA ammonium salt is a bioactive compound frequently employed in lipidomic investigations and pharmacological advancements. Its application is prevalent in the exploration of lysophosphatidic acid (LPA) metabolism and intricate signaling cascades, with a predominant focus on therapeutic interventions targeting malignancies and inflammatory afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1246298-35-0 |
| Pricing | Inquire |
| Cas | 1246298-35-0 |
| Molecular Weight | 439.52 |
| Molecular Formula | C20H42NO7P |
| Canonical SMILES | CCCCCCC=CCCCCCCCCC(=O)OCC(COP(=O)(O)[O-])O.[NH4+] |