6-(3,3-Dimethylallylamino)purine riboside
6-(3,3-Dimethylallylamino)purine riboside is an esteemed compound widely utilized within the biomedical sector assuming a crucial role as an efficacious impediment to A1 adenosine receptors. This attribute bestows upon it the pertinence necessary for comprehensive scrutiny in endeavors directed towards research of afflictions of diverse natures, including neoplastic maladies, metabolic irregularities and immunological dysfunctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 33156-15-9 |
| Pricing | Inquire |
| Cas | 33156-15-9 |
| Molecular Weight | 688.7 |
| Molecular Formula | C30H44N10O9 |
| Canonical SMILES | CC(=CCNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)O)O)C.CC(=CCNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)O)O)C.O |