Leelamine hydrochloride
Leelamine is a diterpene amine exhibiting low affinity for the human central cannabinoid (CB1) and peripheral cannabinoid (CB2) receptors. It also acts as an inhibitor of pyruvate dehydrogenase kinase (PDK). Leelamine inhibits intracellular cholesterol transport and suppresses cancer cell growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16496-99-4 |
| Pricing | Inquire |
| Cas | 16496-99-4 |
| Molecular Weight | 321.9 |
| Molecular Formula | C20H31N·HCl |
| Canonical SMILES | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2)(C)CN)C.Cl |