Phenyl 4,6-O-benzylidene-2,3-di-O-(4-methoxybenzyl)-a-D-thiomannopyranoside
Phenyl 4,6-O-benzylidene-2,3-di-O-(4-methoxybenzyl)-α-D-thiomannopyranoside, an extensively employed compound in the biomedical sector, showcases a remarkable array of therapeutic capabilities, exerting its influence over diverse maladies, encompassing bacterial, viral, and fungal infections. Its intricate mechanism of action enables precise targeting of disease-causing agents, rendering it an indispensable instrument in the realm of biomedicine for drug discovery and advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1416770-33-6 |
| Pricing | Inquire |
| Cas | 1416770-33-6 |
| Molecular Weight | 600.72 |
| Molecular Formula | C35H36O7S |
| Canonical SMILES | COC1=CC=C(C=C1)COC2C3C(COC(O3)C4=CC=CC=C4)OC(C2OCC5=CC=C(C=C5)OC)SC6=CC=CC=C6 |