VEGFR Tyrosine Kinase Inhibitor II
VEGFR tyrosine kinase inhibitor II is a pyridinyl-anthranilamide compound that potently inhibits the kinase activities of VEGFR2 (KDR), VEGFR1 (FLT1), and c-Kit (IC50 = 20, 180, and 240 nM, respectively). It is potential for cancer treatment for its inhibitory effect of tumor induced angiogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 269390-69-4 |
| Pricing | Inquire |
| Cas | 269390-69-4 |
| Molecular Weight | 337.8 |
| Molecular Formula | C19H16ClN3O |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Cl)NCC3=CC=NC=C3 |