Sincalide ammonium
Sincalide, also known as cholecystokinin octapeptide (CCK-8), is a synthetic form of the naturally occurring hormone cholecystokinin. It is used primarily in diagnostic tests to evaluate the function of the gallbladder and pancreas. The ammonium form refers to its salt form for medical use. Sincalide ammonium is a valuable tool in diagnostic medicine, helping healthcare providers diagnose and evaluate conditions related to the gallbladder and pancreas.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70706-98-8 |
| Pricing | Inquire |
| Cas | 70706-98-8 |
| Molecular Weight | 1160.30 |
| Molecular Formula | C49H65N11O16S3 |
| Canonical SMILES | CSCCC(C(=O)NCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(CC3=CC=CC=C3)C(=O)N)NC(=O)C(CC4=CC=C(C=C4)OS(=O)(=O)O)NC(=O)C(CC(=O)O)N.N |