Zymosterone
Zymosterone, a vital enzymatic catalyst utilized within the biomedical sector, serves as a pivotal component in the management of specific endocrine maladies, like adrenal insufficiency. Engaged in the biosynthesis of steroid hormones such as cortisol, aldosterone, and testosterone, it embodies a fundamental pharmacological mechanism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27192-37-6 |
| Pricing | Inquire |
| Cas | 27192-37-6 |
| Molecular Weight | 382.62 |
| Molecular Formula | C27H42O |
| Canonical SMILES | CC(CCC=C(C)C)C1CCC2C1(CCC3=C2CCC4C3(CCC(=O)C4)C)C |