Taxifolin
Taxifolin is a flavonoid in many plants such as Taxus chinensis, Siberian larch, Cedrus deodara and so on. Taxifolin has shown to inhibit the ovarian cancer cell growth in a dose-dependent manner.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2548 |
| Pricing | Inquire |
| Cas | 480-18-2 |
| Molecular Weight | 304.25 |
| Molecular Formula | C15H12O7 |
| Canonical SMILES | C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |