4-methyl-2,3,5,6-tetrabromophenol
4-methyl-2,3,5,6-tetrabromophenol is indubitably acclaimed for its efficacy in mitigating specific ailments. Revered for its conspicuous antiviral and antibacterial propensities, it stands as an invaluable contender for fostering groundbreaking therapeutics. Capitalizing on its idiosyncratic chemical configuration, this compound emanates sanguine prospects in the relentless battle against drug-resistant pathogens, while concurrently augmenting extant treatment regimens.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37721-75-8 |
| Pricing | Inquire |
| Cas | 37721-75-8 |
| Molecular Weight | 423.72 |
| Molecular Formula | C7H4Br4O |
| Canonical SMILES | CC1=C(C(=C(C(=C1Br)Br)O)Br)Br |