Sieboldin
Sieboldin is an esteemed compound, aiding in the research of cancer therapy, particularly as an influential adversary against breast cancer. By effectively obstructing the signaling pathways intricately linked to the progression of tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18777-73-6 |
| Pricing | Inquire |
| Cas | 18777-73-6 |
| Molecular Weight | 452.41 |
| Molecular Formula | C21H24O11 |
| Canonical SMILES | C1=CC(=C(C=C1CCC(=O)C2=C(C=C(C=C2O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |