Coumarin 525
Coumarin 525 is a highly versatile and extensively employed fluorescent dye within the biomedical industry. Its widespread application encompasses the investigation of drug delivery systems, imaging methodologies, as well as cellular mechanisms. Notably, this product occupies a crucial position in the development of drugs used to study cancer, neurological diseases, and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 87331-47-3 |
| Pricing | Inquire |
| Cas | 87331-47-3 |
| Molecular Weight | 358.397 |
| Molecular Formula | C22H18N2O3 |
| Canonical SMILES | C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C5=NC6=CC=CC=C6O5)CCCN3C1 |