XTP - Sodium salt
The base of XTP, xanthine, bears a keto group instead of an amino group at C2 of the purine ring. Xanthosine 5'-triphosphate (XTP), a GTP analogue, is expected to possess an even lower affinity for G-protein cr-subunits than GTP.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105931-36-0 |
| Pricing | Inquire |
| Cas | 105931-36-0 |
| Molecular Weight | 524.16 (free acid) |
| Molecular Formula | C10H15N4O15P3(free acid) |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)([O-])OP(=O)(O)[O-])O)O)NC(=O)NC2=O.[Na+].[Na+] |