Cyanine5 DBCO
A derivative of Cyanine5 red-emitting fluorophore possessing DBCO (dibenzocyclooctyne, also known as ADIBO, azodibenzocyclooctyne) group for copper free Click chemistry.Strained cycloalkynes, such as cyclooctynes, react with azides very rapidly in the absence of copper catalyst in a strain promoted alkyne azide cycloaddition (spAAC). This reaction is very fast, mild, and biocompatible.
| Supplier | BOC Sciences |
|---|---|
| Product # | R09-0005 |
| Pricing | Inquire |
| Molecular Weight | 929.03 |
| Molecular Formula | C53H59N4F6O2P |
| Canonical SMILES | CC1(C2=CC=CC=C2[N+](=C1C=CC=CC=C3C(C4=CC=CC=C4N3CCCCCC(=O)NCCCCCC(=O)N5CC6=CC=CC=C6C#CC7=CC=CC=C75)(C)C)C)C.F[P-](F)(F)(F)(F)F |