Dimethyl 2-(3,5-dichlorophenyl)malonate
Dimethyl 2-(3,5-dichlorophenyl)malonate is an intermediate in the synthesis of Dicloromezotiaz (D434402), a commercial pest control agent. Dicloromezotiaz can provide a useful control tool for lepidopteran pests, with an underexploited mode of action among these pests. A mesoionic insecticide.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068351 |
| Pricing | Inquire |
| Cas | 1443329-48-3 |
| Molecular Weight | 277.1 |
| Molecular Formula | C11H10Cl2O4 |
| Canonical SMILES | COC(=O)C(C1=CC(=CC(=C1)Cl)Cl)C(=O)OC |