Melphalan flufenamide
Melphalan flufenamide, is a melphalan prodrug in which the alkylating agent melphalan is bound to flufenamide, alkylates DNA at the N7 position of guanine residues and induces DNA intra- and inter-strand cross-linkages.
| Supplier | BOC Sciences |
|---|---|
| Product # | 380449-51-4 |
| Pricing | Inquire |
| Cas | 380449-51-4 |
| Molecular Weight | 498.42 |
| Molecular Formula | C24H30Cl2FN3O3 |
| Canonical SMILES | CCOC(=O)C(CC1=CC=C(C=C1)F)NC(=O)C(CC2=CC=C(C=C2)N(CCCl)CCCl)N |