2-Keto-3-(methyl-[d3])-butyric acid-1,2,3,4-[13C4] sodium salt
2-Keto-3-(methyl-[d3])-butyric acid-1,2,3,4-[13C4] sodium salt is intended for use as an internal standard for α-Keto Isovaleric Acid Sodium Salt. 2-Keto-3-(methyl-[d3])-butyric acid-1,2,3,4-[13C4] sodium salt can be used in studies involving the selective isotopic unlabelling of proteins providing important residue-type information.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005676 |
| Pricing | Inquire |
| Cas | 1215605-14-3 |
| Molecular Weight | 145.09 |
| Molecular Formula | [13C]4CH3D3NaO3 |
| Canonical SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |