Hydantocidin
Hydantocidin is a compound with herbicidal activity produced by Streptomyces hygroscopicus SANK 63584. Its weeding effect on monocotyledonous and dicotyledonous annual weeds is stronger than Bialaphos and similar to the commercial Glyphosate.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00978 |
| Pricing | Inquire |
| Cas | 130607-26-0 |
| Molecular Weight | 218.16 |
| Molecular Formula | C7H10N2O6 |
| Canonical SMILES | C(C1C(C(C2(O1)C(=O)NC(=O)N2)O)O)O |