5,7-Dihydroxyphthalide
5,7-Dihydroxyphthalide:
A highly remarkable and scientifically advanced natural compound, renowned for its extraordinary efficacy in studying cancer and ameliorating neurodegenerative disorders. By selectively modulating precise molecular pathways pivotal in cancer development, it effectively hinders tumor proliferation. Remarkably, it also exhibits remarkable prospect as a neuroprotective agent, proficiently studying oxidative stress and inflammatory responses associated with neurodegenerative ailments. Its multidimensional therapeutic properties make it an invaluable intervention for individuals battling these formidable medical conditions.
A highly remarkable and scientifically advanced natural compound, renowned for its extraordinary efficacy in studying cancer and ameliorating neurodegenerative disorders. By selectively modulating precise molecular pathways pivotal in cancer development, it effectively hinders tumor proliferation. Remarkably, it also exhibits remarkable prospect as a neuroprotective agent, proficiently studying oxidative stress and inflammatory responses associated with neurodegenerative ailments. Its multidimensional therapeutic properties make it an invaluable intervention for individuals battling these formidable medical conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5153 |
| Pricing | Inquire |
| Cas | 27979-58-4 |
| Molecular Weight | 166.132 |
| Molecular Formula | C8H6O4 |
| Canonical SMILES | C1C2=CC(=CC(=C2C(=O)O1)O)O |