Saikosaponin D
Saikosaponin D is extracted from the root of Bupleurum chinense DC. It protects against acetaminophen-induced hepatotoxicity by inhibiting NF-κB and STAT3 signaling. It possesses potent cytotoxicity against human hepatocellular carcinoma cells. It inhibits cell growth of human cancer cells by inducing apoptosis and blocking cell cycle progression in the G1 phase. It was found to stimulate corticotropin-releasing factor (CRF) gene expression and CRF release.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7004 |
| Pricing | Inquire |
| Cas | 20874-52-6 |
| Molecular Weight | 780.98 |
| Molecular Formula | C42H68O13 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C=CC56C4(CC(C7(C5CC(CC7)(C)C)CO6)O)C)C)C)O)OC8C(C(C(C(O8)CO)O)O)O)O |