Tylosin
Tylosin is a 16-member-ring macrolide produced through the fermentation of Streptomyces fradiae, a species of actinobacteria found in soil. It is effective against gram-positive bacteria, Mycoplasma species and certain gram-negative bacteria. With other macrolides, tylosin inhibits protein synthesis by binding to the 50S subunit of the bacterial ribosome and disrupting aminoacyl-and peptidyl-tRNA transcription. This is believed to ultimately prevent the bacteria from reproducing.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03431 |
| Pricing | Inquire |
| Cas | 1401-69-0 |
| Molecular Weight | 916.10 |
| Molecular Formula | C46H77NO17 |
| Canonical SMILES | CCC1C(C=C(C=CC(=O)C(CC(C(C(C(CC(=O)O1)O)C)OC2C(C(C(C(O2)C)OC3CC(C(C(O3)C)O)(C)O)N(C)C)O)CC=O)C)C)COC4C(C(C(C(O4)C)O)OC)OC |