Phenyl 3-O-benzyl-b-D-thioglucopyranoside
Phenyl 3-O-benzyl-b-D-thioglucopyranoside is an exceptionally potent compound utilized extensively for meticulously studying the intricate webs of carbohydrate metabolism pathways. This extraordinary product aids to comprehensively investigate the profound impact of cellular reactions concerning precise glycosylation processes, thus facilating the adept research of various maladies intricately entangled within aberrant glycosylations, for instance, the formidable adversaries of cancer, diabetes and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 189144-54-5 |
| Pricing | Inquire |
| Cas | 189144-54-5 |
| Molecular Weight | 362.44 |
| Molecular Formula | C19H22O5S |
| Canonical SMILES | C1=CC=C(C=C1)COC2C(C(OC(C2O)SC3=CC=CC=C3)CO)O |