3'-O-DMTr-2'-O-Me-rU-5'-CE-Phosphoramidite
3'-O-DMTr-2'-O-Me-rU-5'-CE-Phosphoramidite is a specialized nucleotide used in oligonucleotide synthesis. It contains a 3'-dimethoxytrityl (DMTr) protecting group on the 3' hydroxyl, a methyl (Me) modification at the 2' position of the ribose sugar with uracil (U) as the base, and a 5'-cyanoethyl (CE) phosphoramidite functionality for controlled addition during synthesis. This compound facilitates stable and precise synthesis of customized oligonucleotides for molecular biology research applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00430 |
| Pricing | Inquire |
| Cas | 2721427-32-1 |
| Molecular Weight | 760.82 |
| Molecular Formula | C40H49N4O9P |
| Canonical SMILES | N#CCCOP(OCC1OC(N2C=CC(=O)NC2=O)C(OC)C1OC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)N(C(C)C)C(C)C |